C23H20F3N3O6S — CID 25063195
[(3S)-3-[[6-(3,3,3-trifluoropropoxy)pyridine-3-carbonyl]amino]-3,4-dihydro-2H-chromen-5-yl] pyridine-3-sulfonate (PubChem CID 25063195) has the molecular formula C23H20F3N3O6S and a molecular weight of 523.49 g/mol. Its IUPAC name is [(3S)-3-[[6-(3,3,3-trifluoropropoxy)pyridine-3-carbonyl]amino]-3,4-dihydro-2H-chromen-5-yl] pyridine-3-sulfonate.
| Compound Name | [(3S)-3-[[6-(3,3,3-trifluoropropoxy)pyridine-3-carbonyl]amino]-3,4-dihydro-2H-chromen-5-yl] pyridine-3-sulfonate |
|---|---|
| PubChem CID | 25063195 |
| Molecular Formula | C23H20F3N3O6S |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | [(3S)-3-[[6-(3,3,3-trifluoropropoxy)pyridine-3-carbonyl]amino]-3,4-dihydro-2H-chromen-5-yl] pyridine-3-sulfonate |
| SMILES | O=C(N[C@@H]1COc2cccc(OS(=O)(=O)c3cccnc3)c2C1)c1ccc(OCCC(F)(F)F)nc1 |
| InChI | InChI=1S/C23H20F3N3O6S/c24-23(25,26)8-10-33-21-7-6-15(12-28-21)22(30)29-16-11-18-19(34-14-16)4-1-5-20(18)35-36(31,32)17-3-2-9-27-13-17/h1-7,9,12-13,16H,8,10-11,14H2,(H,29,30)/t16-/m0/s1 |
| InChIKey | LUVFLRHPYKEWLT-INIZCTEOSA-N |
| XLogP | 3.31 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|