C28H19F3N6O — CID 25064048
(3Z)-3-(1H-pyrrol-2-ylmethylidene)-6-[3-[5-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-yl]anilino]-1H-indol-2-one (PubChem CID 25064048) has the molecular formula C28H19F3N6O and a molecular weight of 512.50 g/mol. Its IUPAC name is (3Z)-3-(1H-pyrrol-2-ylmethylidene)-6-[3-[5-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-yl]anilino]-1H-indol-2-one.
| Compound Name | (3Z)-3-(1H-pyrrol-2-ylmethylidene)-6-[3-[5-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-yl]anilino]-1H-indol-2-one |
|---|---|
| PubChem CID | 25064048 |
| Molecular Formula | C28H19F3N6O |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | (3Z)-3-(1H-pyrrol-2-ylmethylidene)-6-[3-[5-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-yl]anilino]-1H-indol-2-one |
| SMILES | O=C1Nc2cc(Nc3cccc(-c4n[nH]c(-c5ccc(C(F)(F)F)cc5)n4)c3)ccc2/C1=C/c1ccc[nH]1 |
| InChI | InChI=1S/C28H19F3N6O/c29-28(30,31)18-8-6-16(7-9-18)25-35-26(37-36-25)17-3-1-4-20(13-17)33-21-10-11-22-23(14-19-5-2-12-32-19)27(38)34-24(22)15-21/h1-15,32-33H,(H,34,38)(H,35,36,37)/b23-14- |
| InChIKey | VKNTYCZHYYPMTA-UCQKPKSFSA-N |
| XLogP | 6.72 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|