C16H25N5O13S3 — CID 25064356
2,3-dinitrooxypropyl N-ethyl-N-[(4R)-2-(3-methoxypropyl)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]carbamate (PubChem CID 25064356) has the molecular formula C16H25N5O13S3 and a molecular weight of 591.60 g/mol. Its IUPAC name is 2,3-dinitrooxypropyl N-ethyl-N-[(4R)-2-(3-methoxypropyl)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]carbamate.
| Compound Name | 2,3-dinitrooxypropyl N-ethyl-N-[(4R)-2-(3-methoxypropyl)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]carbamate |
|---|---|
| PubChem CID | 25064356 |
| Molecular Formula | C16H25N5O13S3 |
| Molecular Weight | 591.60 g/mol |
| Exact Mass | 591.06 |
| IUPAC Name | 2,3-dinitrooxypropyl N-ethyl-N-[(4R)-2-(3-methoxypropyl)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]carbamate |
| SMILES | CCN(C(=O)OCC(CO[N+](=O)[O-])O[N+](=O)[O-])[C@H]1CN(CCCOC)S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C16H25N5O13S3/c1-3-19(16(22)32-9-11(34-21(25)26)10-33-20(23)24)13-8-18(5-4-6-31-2)37(29,30)15-12(13)7-14(35-15)36(17,27)28/h7,11,13H,3-6,8-10H2,1-2H3,(H2,17,27,28)/t11?,13-/m0/s1 |
| InChIKey | WIZSDLRVHXDZBB-YUZLPWPTSA-N |
| XLogP | -0.28 |
| TPSA | 241.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.60 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|