C17H21F3N2O5S — CID 25064606
1-[(3aR,5S,6S,6aR)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 25064606) has the molecular formula C17H21F3N2O5S and a molecular weight of 422.43 g/mol. Its IUPAC name is 1-[(3aR,5S,6S,6aR)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(3aR,5S,6S,6aR)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 25064606 |
| Molecular Formula | C17H21F3N2O5S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 1-[(3aR,5S,6S,6aR)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H](O)CO)[C@H](NC(=S)Nc3ccc(C(F)(F)F)cc3)[C@H]2O1 |
| InChI | InChI=1S/C17H21F3N2O5S/c1-16(2)26-13-11(12(10(24)7-23)25-14(13)27-16)22-15(28)21-9-5-3-8(4-6-9)17(18,19)20/h3-6,10-14,23-24H,7H2,1-2H3,(H2,21,22,28)/t10-,11+,12-,13-,14-/m1/s1 |
| InChIKey | ASOFDFDPWBFDEE-XVIXHAIJSA-N |
| XLogP | 1.59 |
| TPSA | 92.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|