C20H31N5O13S3 — CID 25064767
[4-[ethyl-[(4R)-2-(3-methoxypropyl)-6-(4-nitrooxybutanoylsulfamoyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl]amino]-4-oxobutyl] nitrate (PubChem CID 25064767) has the molecular formula C20H31N5O13S3 and a molecular weight of 645.69 g/mol. Its IUPAC name is [4-[ethyl-[(4R)-2-(3-methoxypropyl)-6-(4-nitrooxybutanoylsulfamoyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl]amino]-4-oxobutyl] nitrate.
| Compound Name | [4-[ethyl-[(4R)-2-(3-methoxypropyl)-6-(4-nitrooxybutanoylsulfamoyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl]amino]-4-oxobutyl] nitrate |
|---|---|
| PubChem CID | 25064767 |
| Molecular Formula | C20H31N5O13S3 |
| Molecular Weight | 645.69 g/mol |
| Exact Mass | 645.11 |
| IUPAC Name | [4-[ethyl-[(4R)-2-(3-methoxypropyl)-6-(4-nitrooxybutanoylsulfamoyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl]amino]-4-oxobutyl] nitrate |
| SMILES | CCN(C(=O)CCCO[N+](=O)[O-])[C@H]1CN(CCCOC)S(=O)(=O)c2sc(S(=O)(=O)NC(=O)CCCO[N+](=O)[O-])cc21 |
| InChI | InChI=1S/C20H31N5O13S3/c1-3-23(18(27)8-5-12-38-25(30)31)16-14-22(9-6-10-36-2)41(34,35)20-15(16)13-19(39-20)40(32,33)21-17(26)7-4-11-37-24(28)29/h13,16H,3-12,14H2,1-2H3,(H,21,26)/t16-/m0/s1 |
| InChIKey | MRIHXOQHEGJHHX-INIZCTEOSA-N |
| XLogP | 0.46 |
| TPSA | 234.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.69 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|