C22H35N5O15S3 — CID 25064770
4-nitrooxybutyl N-ethyl-N-[(4R)-2-(3-methoxypropyl)-6-(4-nitrooxybutoxycarbonylsulfamoyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl]carbamate (PubChem CID 25064770) has the molecular formula C22H35N5O15S3 and a molecular weight of 705.74 g/mol. Its IUPAC name is 4-nitrooxybutyl N-ethyl-N-[(4R)-2-(3-methoxypropyl)-6-(4-nitrooxybutoxycarbonylsulfamoyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl]carbamate.
| Compound Name | 4-nitrooxybutyl N-ethyl-N-[(4R)-2-(3-methoxypropyl)-6-(4-nitrooxybutoxycarbonylsulfamoyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl]carbamate |
|---|---|
| PubChem CID | 25064770 |
| Molecular Formula | C22H35N5O15S3 |
| Molecular Weight | 705.74 g/mol |
| Exact Mass | 705.13 |
| IUPAC Name | 4-nitrooxybutyl N-ethyl-N-[(4R)-2-(3-methoxypropyl)-6-(4-nitrooxybutoxycarbonylsulfamoyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl]carbamate |
| SMILES | CCN(C(=O)OCCCCO[N+](=O)[O-])[C@H]1CN(CCCOC)S(=O)(=O)c2sc(S(=O)(=O)NC(=O)OCCCCO[N+](=O)[O-])cc21 |
| InChI | InChI=1S/C22H35N5O15S3/c1-3-25(22(29)40-12-5-7-14-42-27(32)33)18-16-24(9-8-10-38-2)45(36,37)20-17(18)15-19(43-20)44(34,35)23-21(28)39-11-4-6-13-41-26(30)31/h15,18H,3-14,16H2,1-2H3,(H,23,28)/t18-/m0/s1 |
| InChIKey | FJTRNTQYBFQBFN-SFHVURJKSA-N |
| XLogP | 1.68 |
| TPSA | 253.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.74 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|