C20H30O3 — CID 25064773
(4S,5S,6R)-5-[(2E,4E,7E)-6,10-dimethylundeca-2,4,7-trien-2-yl]-4,6-dihydroxy-2-methylcyclohex-2-en-1-one (PubChem CID 25064773) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (4S,5S,6R)-5-[(2E,4E,7E)-6,10-dimethylundeca-2,4,7-trien-2-yl]-4,6-dihydroxy-2-methylcyclohex-2-en-1-one.
| Compound Name | (4S,5S,6R)-5-[(2E,4E,7E)-6,10-dimethylundeca-2,4,7-trien-2-yl]-4,6-dihydroxy-2-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 25064773 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (4S,5S,6R)-5-[(2E,4E,7E)-6,10-dimethylundeca-2,4,7-trien-2-yl]-4,6-dihydroxy-2-methylcyclohex-2-en-1-one |
| SMILES | CC1=C[C@H](O)[C@H](/C(C)=C/C=C/C(C)/C=C/CC(C)C)[C@@H](O)C1=O |
| InChI | InChI=1S/C20H30O3/c1-13(2)8-6-9-14(3)10-7-11-15(4)18-17(21)12-16(5)19(22)20(18)23/h6-7,9-14,17-18,20-21,23H,8H2,1-5H3/b9-6+,10-7+,15-11+/t14?,17-,18-,20+/m0/s1 |
| InChIKey | IDIPXJDNKVPXGY-GROVPGHZSA-N |
| XLogP | 3.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|