C26H43N5O15S3 — CID 25064977
6-nitrooxyhexyl N-ethyl-N-[(4R)-2-(3-methoxypropyl)-6-(6-nitrooxyhexoxycarbonylsulfamoyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl]carbamate (PubChem CID 25064977) has the molecular formula C26H43N5O15S3 and a molecular weight of 761.85 g/mol. Its IUPAC name is 6-nitrooxyhexyl N-ethyl-N-[(4R)-2-(3-methoxypropyl)-6-(6-nitrooxyhexoxycarbonylsulfamoyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl]carbamate.
| Compound Name | 6-nitrooxyhexyl N-ethyl-N-[(4R)-2-(3-methoxypropyl)-6-(6-nitrooxyhexoxycarbonylsulfamoyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl]carbamate |
|---|---|
| PubChem CID | 25064977 |
| Molecular Formula | C26H43N5O15S3 |
| Molecular Weight | 761.85 g/mol |
| Exact Mass | 761.19 |
| IUPAC Name | 6-nitrooxyhexyl N-ethyl-N-[(4R)-2-(3-methoxypropyl)-6-(6-nitrooxyhexoxycarbonylsulfamoyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl]carbamate |
| SMILES | CCN(C(=O)OCCCCCCO[N+](=O)[O-])[C@H]1CN(CCCOC)S(=O)(=O)c2sc(S(=O)(=O)NC(=O)OCCCCCCO[N+](=O)[O-])cc21 |
| InChI | InChI=1S/C26H43N5O15S3/c1-3-29(26(33)44-16-9-5-7-11-18-46-31(36)37)22-20-28(13-12-14-42-2)49(40,41)24-21(22)19-23(47-24)48(38,39)27-25(32)43-15-8-4-6-10-17-45-30(34)35/h19,22H,3-18,20H2,1-2H3,(H,27,32)/t22-/m0/s1 |
| InChIKey | UGUCOYVOHNELFZ-QFIPXVFZSA-N |
| XLogP | 3.24 |
| TPSA | 253.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.85 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|