C22H34N4O12S3 — CID 25064980
[6-[ethyl-[(4S)-6-methyl-2-(6-nitrooxyhexanoylsulfamoyl)-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]amino]-6-oxohexyl] nitrate (PubChem CID 25064980) has the molecular formula C22H34N4O12S3 and a molecular weight of 642.73 g/mol. Its IUPAC name is [6-[ethyl-[(4S)-6-methyl-2-(6-nitrooxyhexanoylsulfamoyl)-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]amino]-6-oxohexyl] nitrate.
| Compound Name | [6-[ethyl-[(4S)-6-methyl-2-(6-nitrooxyhexanoylsulfamoyl)-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]amino]-6-oxohexyl] nitrate |
|---|---|
| PubChem CID | 25064980 |
| Molecular Formula | C22H34N4O12S3 |
| Molecular Weight | 642.73 g/mol |
| Exact Mass | 642.13 |
| IUPAC Name | [6-[ethyl-[(4S)-6-methyl-2-(6-nitrooxyhexanoylsulfamoyl)-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]amino]-6-oxohexyl] nitrate |
| SMILES | CCN(C(=O)CCCCCO[N+](=O)[O-])[C@H]1CC(C)S(=O)(=O)c2sc(S(=O)(=O)NC(=O)CCCCCO[N+](=O)[O-])cc21 |
| InChI | InChI=1S/C22H34N4O12S3/c1-3-24(20(28)11-7-5-9-13-38-26(31)32)18-14-16(2)40(33,34)22-17(18)15-21(39-22)41(35,36)23-19(27)10-6-4-8-12-37-25(29)30/h15-16,18H,3-14H2,1-2H3,(H,23,27)/t16?,18-/m0/s1 |
| InChIKey | KFDNEGYPKJUKOS-DAFXYXGESA-N |
| XLogP | 2.55 |
| TPSA | 222.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.73 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|