C40H52N10O4 — CID 25064989
1-N,4-N-bis[[1,6-diethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridin-5-yl]methyl]benzene-1,4-dicarboxamide (PubChem CID 25064989) has the molecular formula C40H52N10O4 and a molecular weight of 736.92 g/mol. Its IUPAC name is 1-N,4-N-bis[[1,6-diethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridin-5-yl]methyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[[1,6-diethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridin-5-yl]methyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 25064989 |
| Molecular Formula | C40H52N10O4 |
| Molecular Weight | 736.92 g/mol |
| Exact Mass | 736.42 |
| IUPAC Name | 1-N,4-N-bis[[1,6-diethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridin-5-yl]methyl]benzene-1,4-dicarboxamide |
| SMILES | CCc1nc2c(cnn2CC)c(NC2CCOCC2)c1CNC(=O)c1ccc(C(=O)NCc2c(CC)nc3c(cnn3CC)c2NC2CCOCC2)cc1 |
| InChI | InChI=1S/C40H52N10O4/c1-5-33-29(35(45-27-13-17-53-18-14-27)31-23-43-49(7-3)37(31)47-33)21-41-39(51)25-9-11-26(12-10-25)40(52)42-22-30-34(6-2)48-38-32(24-44-50(38)8-4)36(30)46-28-15-19-54-20-16-28/h9-12,23-24,27-28H,5-8,13-22H2,1-4H3,(H,41,51)(H,42,52)(H,45,47)(H,46,48) |
| InChIKey | YQVTVGJGJLRHHX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.92 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |