C30H34N4 — CID 25065047
1-(2,4-dimethylphenyl)-4-[3-(1,5-diphenylpyrazol-3-yl)propyl]piperazine (PubChem CID 25065047) has the molecular formula C30H34N4 and a molecular weight of 450.63 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-4-[3-(1,5-diphenylpyrazol-3-yl)propyl]piperazine.
| Compound Name | 1-(2,4-dimethylphenyl)-4-[3-(1,5-diphenylpyrazol-3-yl)propyl]piperazine |
|---|---|
| PubChem CID | 25065047 |
| Molecular Formula | C30H34N4 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-4-[3-(1,5-diphenylpyrazol-3-yl)propyl]piperazine |
| SMILES | Cc1ccc(N2CCN(CCCc3cc(-c4ccccc4)n(-c4ccccc4)n3)CC2)c(C)c1 |
| InChI | InChI=1S/C30H34N4/c1-24-15-16-29(25(2)22-24)33-20-18-32(19-21-33)17-9-12-27-23-30(26-10-5-3-6-11-26)34(31-27)28-13-7-4-8-14-28/h3-8,10-11,13-16,22-23H,9,12,17-21H2,1-2H3 |
| InChIKey | FPROSUDFWFOZOY-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |