About 1-benzyl-4-[4-(3,5-difluoro-2-pyridinyl)piperazin-1-yl]phthalazine
1-benzyl-4-[4-(3,5-difluoro-2-pyridinyl)piperazin-1-yl]phthalazine (PubChem CID 25065067) has the molecular formula C24H21F2N5
and a molecular weight of 417.46 g/mol. Its IUPAC name is 1-benzyl-4-[4-(3,5-difluoro-2-pyridinyl)piperazin-1-yl]phthalazine.
Molecular Properties
| Compound Name | 1-benzyl-4-[4-(3,5-difluoro-2-pyridinyl)piperazin-1-yl]phthalazine |
| PubChem CID | 25065067 |
| Molecular Formula | C24H21F2N5 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 1-benzyl-4-[4-(3,5-difluoro-2-pyridinyl)piperazin-1-yl]phthalazine |
| SMILES | Fc1cnc(N2CCN(c3nnc(Cc4ccccc4)c4ccccc34)CC2)c(F)c1 |
| InChI | InChI=1S/C24H21F2N5/c25-18-15-21(26)24(27-16-18)31-12-10-30(11-13-31)23-20-9-5-4-8-19(20)22(28-29-23)14-17-6-2-1-3-7-17/h1-9,15-16H,10-14H2 |
| InChIKey | ADSXBWXAYYALMU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-4-[4-(3,5-difluoro-2-pyridinyl)piperazin-1-yl]phthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-[4-(3,5-difluoro-2-pyridinyl)piperazin-1-yl]phthalazine?
The IUPAC name of 1-benzyl-4-[4-(3,5-difluoro-2-pyridinyl)piperazin-1-yl]phthalazine (CID 25065067) is 1-benzyl-4-[4-(3,5-difluoro-2-pyridinyl)piperazin-1-yl]phthalazine.
What is the SMILES notation for 1-benzyl-4-[4-(3,5-difluoro-2-pyridinyl)piperazin-1-yl]phthalazine?
The canonical SMILES for 1-benzyl-4-[4-(3,5-difluoro-2-pyridinyl)piperazin-1-yl]phthalazine is Fc1cnc(N2CCN(c3nnc(Cc4ccccc4)c4ccccc34)CC2)c(F)c1.
What is the InChIKey of 1-benzyl-4-[4-(3,5-difluoro-2-pyridinyl)piperazin-1-yl]phthalazine?
The InChIKey is ADSXBWXAYYALMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21F2N5/c25-18-15-21(26)24(27-16-18)31-12-10-30(11-13-31)23-20-9-5-4-8-19(20)22(28-29-23)14-17-6-2-1-3-7-17/h1-9,15-16H,10-14H2.
What are the key properties of 1-benzyl-4-[4-(3,5-difluoro-2-pyridinyl)piperazin-1-yl]phthalazine?
1-benzyl-4-[4-(3,5-difluoro-2-pyridinyl)piperazin-1-yl]phthalazine has a molecular weight of 417.46 g/mol, XLogP of 4.22, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-[4-(3,5-difluoro-2-pyridinyl)piperazin-1-yl]phthalazine is sourced from PubChem (CID 25065067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).