C20H30N4O14S3 — CID 25065182
4-nitrooxybutyl N-ethyl-N-[(4S)-6-methyl-2-(4-nitrooxybutoxycarbonylsulfamoyl)-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]carbamate (PubChem CID 25065182) has the molecular formula C20H30N4O14S3 and a molecular weight of 646.67 g/mol. Its IUPAC name is 4-nitrooxybutyl N-ethyl-N-[(4S)-6-methyl-2-(4-nitrooxybutoxycarbonylsulfamoyl)-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]carbamate.
| Compound Name | 4-nitrooxybutyl N-ethyl-N-[(4S)-6-methyl-2-(4-nitrooxybutoxycarbonylsulfamoyl)-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]carbamate |
|---|---|
| PubChem CID | 25065182 |
| Molecular Formula | C20H30N4O14S3 |
| Molecular Weight | 646.67 g/mol |
| Exact Mass | 646.09 |
| IUPAC Name | 4-nitrooxybutyl N-ethyl-N-[(4S)-6-methyl-2-(4-nitrooxybutoxycarbonylsulfamoyl)-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]carbamate |
| SMILES | CCN(C(=O)OCCCCO[N+](=O)[O-])[C@H]1CC(C)S(=O)(=O)c2sc(S(=O)(=O)NC(=O)OCCCCO[N+](=O)[O-])cc21 |
| InChI | InChI=1S/C20H30N4O14S3/c1-3-22(20(26)36-9-5-7-11-38-24(29)30)16-12-14(2)40(31,32)18-15(16)13-17(39-18)41(33,34)21-19(25)35-8-4-6-10-37-23(27)28/h13-14,16H,3-12H2,1-2H3,(H,21,25)/t14?,16-/m0/s1 |
| InChIKey | RSSNPODZGSMJSV-WMCAAGNKSA-N |
| XLogP | 2.21 |
| TPSA | 240.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.67 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|