C24H38N4O14S3 — CID 25065183
6-nitrooxyhexyl N-ethyl-N-[(4S)-6-methyl-2-(6-nitrooxyhexoxycarbonylsulfamoyl)-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]carbamate (PubChem CID 25065183) has the molecular formula C24H38N4O14S3 and a molecular weight of 702.78 g/mol. Its IUPAC name is 6-nitrooxyhexyl N-ethyl-N-[(4S)-6-methyl-2-(6-nitrooxyhexoxycarbonylsulfamoyl)-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]carbamate.
| Compound Name | 6-nitrooxyhexyl N-ethyl-N-[(4S)-6-methyl-2-(6-nitrooxyhexoxycarbonylsulfamoyl)-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]carbamate |
|---|---|
| PubChem CID | 25065183 |
| Molecular Formula | C24H38N4O14S3 |
| Molecular Weight | 702.78 g/mol |
| Exact Mass | 702.15 |
| IUPAC Name | 6-nitrooxyhexyl N-ethyl-N-[(4S)-6-methyl-2-(6-nitrooxyhexoxycarbonylsulfamoyl)-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]carbamate |
| SMILES | CCN(C(=O)OCCCCCCO[N+](=O)[O-])[C@H]1CC(C)S(=O)(=O)c2sc(S(=O)(=O)NC(=O)OCCCCCCO[N+](=O)[O-])cc21 |
| InChI | InChI=1S/C24H38N4O14S3/c1-3-26(24(30)40-13-9-5-7-11-15-42-28(33)34)20-16-18(2)44(35,36)22-19(20)17-21(43-22)45(37,38)25-23(29)39-12-8-4-6-10-14-41-27(31)32/h17-18,20H,3-16H2,1-2H3,(H,25,29)/t18?,20-/m0/s1 |
| InChIKey | ZMUPPEIDTJFDNH-IJHRGXPZSA-N |
| XLogP | 3.77 |
| TPSA | 240.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|