C21H28F3N2O6S2+ — CID 25065507
[(2R)-3-carboxy-2-[[5-(2-phenylethyl)thiophen-2-yl]sulfonylamino]propyl]-trimethylazanium;2,2,2-trifluoroacetic acid (PubChem CID 25065507) has the molecular formula C21H28F3N2O6S2+ and a molecular weight of 525.59 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[[5-(2-phenylethyl)thiophen-2-yl]sulfonylamino]propyl]-trimethylazanium;2,2,2-trifluoroacetic acid.
| Compound Name | [(2R)-3-carboxy-2-[[5-(2-phenylethyl)thiophen-2-yl]sulfonylamino]propyl]-trimethylazanium;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 25065507 |
| Molecular Formula | C21H28F3N2O6S2+ |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | [(2R)-3-carboxy-2-[[5-(2-phenylethyl)thiophen-2-yl]sulfonylamino]propyl]-trimethylazanium;2,2,2-trifluoroacetic acid |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)O)NS(=O)(=O)c1ccc(CCc2ccccc2)s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H26N2O4S2.C2HF3O2/c1-21(2,3)14-16(13-18(22)23)20-27(24,25)19-12-11-17(26-19)10-9-15-7-5-4-6-8-15;3-2(4,5)1(6)7/h4-8,11-12,16,20H,9-10,13-14H2,1-3H3;(H,6,7)/p+1/t16-;/m1./s1 |
| InChIKey | INUNXPQAVULNEM-PKLMIRHRSA-O |
| XLogP | 2.99 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|