C17H28N4O10S3 — CID 25065583
4-nitrooxybutyl N-[[(4R)-4-(ethylamino)-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-6-yl]sulfonyl]carbamate (PubChem CID 25065583) has the molecular formula C17H28N4O10S3 and a molecular weight of 544.63 g/mol. Its IUPAC name is 4-nitrooxybutyl N-[[(4R)-4-(ethylamino)-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-6-yl]sulfonyl]carbamate.
| Compound Name | 4-nitrooxybutyl N-[[(4R)-4-(ethylamino)-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-6-yl]sulfonyl]carbamate |
|---|---|
| PubChem CID | 25065583 |
| Molecular Formula | C17H28N4O10S3 |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | 4-nitrooxybutyl N-[[(4R)-4-(ethylamino)-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-6-yl]sulfonyl]carbamate |
| SMILES | CCN[C@H]1CN(CCCOC)S(=O)(=O)c2sc(S(=O)(=O)NC(=O)OCCCCO[N+](=O)[O-])cc21 |
| InChI | InChI=1S/C17H28N4O10S3/c1-3-18-14-12-20(7-6-8-29-2)34(27,28)16-13(14)11-15(32-16)33(25,26)19-17(22)30-9-4-5-10-31-21(23)24/h11,14,18H,3-10,12H2,1-2H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | UTPXWHVSIXSCKE-AWEZNQCLSA-N |
| XLogP | 0.84 |
| TPSA | 183.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|