C29H37NO8 — CID 25065635
[(2S)-2-[(2S)-2-amino-3-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]propanoyl]oxypropyl] benzoate (PubChem CID 25065635) has the molecular formula C29H37NO8 and a molecular weight of 527.61 g/mol. Its IUPAC name is [(2S)-2-[(2S)-2-amino-3-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]propanoyl]oxypropyl] benzoate.
| Compound Name | [(2S)-2-[(2S)-2-amino-3-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]propanoyl]oxypropyl] benzoate |
|---|---|
| PubChem CID | 25065635 |
| Molecular Formula | C29H37NO8 |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | [(2S)-2-[(2S)-2-amino-3-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]propanoyl]oxypropyl] benzoate |
| SMILES | C[C@@H](COC(=O)c1ccccc1)OC(=O)[C@@H](N)Cc1ccc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C29H37NO8/c1-18(17-35-24(31)20-11-9-8-10-12-20)36-25(32)21(30)15-19-13-14-22(37-26(33)28(2,3)4)23(16-19)38-27(34)29(5,6)7/h8-14,16,18,21H,15,17,30H2,1-7H3/t18-,21-/m0/s1 |
| InChIKey | XIUDAZPDKRFPSF-RXVVDRJESA-N |
| XLogP | 4.25 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|