C27H41N3O5S — CID 25065842
1-[(3aR,5S,6S,6aR)-5-[(1R)-1,2-dipentoxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-cyanophenyl)thiourea (PubChem CID 25065842) has the molecular formula C27H41N3O5S and a molecular weight of 519.71 g/mol. Its IUPAC name is 1-[(3aR,5S,6S,6aR)-5-[(1R)-1,2-dipentoxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-cyanophenyl)thiourea.
| Compound Name | 1-[(3aR,5S,6S,6aR)-5-[(1R)-1,2-dipentoxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-cyanophenyl)thiourea |
|---|---|
| PubChem CID | 25065842 |
| Molecular Formula | C27H41N3O5S |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | 1-[(3aR,5S,6S,6aR)-5-[(1R)-1,2-dipentoxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-cyanophenyl)thiourea |
| SMILES | CCCCCOC[C@@H](OCCCCC)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1NC(=S)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C27H41N3O5S/c1-5-7-9-15-31-18-21(32-16-10-8-6-2)23-22(24-25(33-23)35-27(3,4)34-24)30-26(36)29-20-13-11-19(17-28)12-14-20/h11-14,21-25H,5-10,15-16,18H2,1-4H3,(H2,29,30,36)/t21-,22+,23-,24-,25-/m1/s1 |
| InChIKey | KXLUCMLCKSACEM-QERLCLQCSA-N |
| XLogP | 4.87 |
| TPSA | 94.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|