C12H8O6 — CID 25066560
7,8,9-trihydroxy-3-methylpyrano[4,3-b][1]benzofuran-1-one (PubChem CID 25066560) has the molecular formula C12H8O6 and a molecular weight of 248.19 g/mol. Its IUPAC name is 7,8,9-trihydroxy-3-methylpyrano[4,3-b][1]benzofuran-1-one.
| Compound Name | 7,8,9-trihydroxy-3-methylpyrano[4,3-b][1]benzofuran-1-one |
|---|---|
| PubChem CID | 25066560 |
| Molecular Formula | C12H8O6 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 7,8,9-trihydroxy-3-methylpyrano[4,3-b][1]benzofuran-1-one |
| SMILES | Cc1cc2oc3cc(O)c(O)c(O)c3c2c(=O)o1 |
| InChI | InChI=1S/C12H8O6/c1-4-2-6-9(12(16)17-4)8-7(18-6)3-5(13)10(14)11(8)15/h2-3,13-15H,1H3 |
| InChIKey | BYPYTMUISXPKAB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|