About N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide
N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide (PubChem CID 25066983) has the molecular formula C20H12Cl3N3O
and a molecular weight of 416.70 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide |
| PubChem CID | 25066983 |
| Molecular Formula | C20H12Cl3N3O |
| Molecular Weight | 416.70 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1ccc2nc(-c3c(Cl)cccc3Cl)[nH]c2c1 |
| InChI | InChI=1S/C20H12Cl3N3O/c21-12-5-7-13(8-6-12)24-20(27)11-4-9-16-17(10-11)26-19(25-16)18-14(22)2-1-3-15(18)23/h1-10H,(H,24,27)(H,25,26) |
| InChIKey | GLUCVAZWFKCTHF-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.70 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide?
The IUPAC name of N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide (CID 25066983) is N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide.
What is the SMILES notation for N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide?
The canonical SMILES for N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide is O=C(Nc1ccc(Cl)cc1)c1ccc2nc(-c3c(Cl)cccc3Cl)[nH]c2c1.
What is the InChIKey of N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide?
The InChIKey is GLUCVAZWFKCTHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12Cl3N3O/c21-12-5-7-13(8-6-12)24-20(27)11-4-9-16-17(10-11)26-19(25-16)18-14(22)2-1-3-15(18)23/h1-10H,(H,24,27)(H,25,26).
What are the key properties of N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide?
N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide has a molecular weight of 416.70 g/mol, XLogP of 6.44, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide is sourced from PubChem (CID 25066983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).