C16H26N4O9S4 — CID 25067251
2-[2-[ethyl-[(4R)-2-(3-methoxypropyl)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]amino]-2-oxoethyl]sulfanylethyl nitrate (PubChem CID 25067251) has the molecular formula C16H26N4O9S4 and a molecular weight of 546.67 g/mol. Its IUPAC name is 2-[2-[ethyl-[(4R)-2-(3-methoxypropyl)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]amino]-2-oxoethyl]sulfanylethyl nitrate.
| Compound Name | 2-[2-[ethyl-[(4R)-2-(3-methoxypropyl)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]amino]-2-oxoethyl]sulfanylethyl nitrate |
|---|---|
| PubChem CID | 25067251 |
| Molecular Formula | C16H26N4O9S4 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | 2-[2-[ethyl-[(4R)-2-(3-methoxypropyl)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]amino]-2-oxoethyl]sulfanylethyl nitrate |
| SMILES | CCN(C(=O)CSCCO[N+](=O)[O-])[C@H]1CN(CCCOC)S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C16H26N4O9S4/c1-3-19(14(21)11-30-8-7-29-20(22)23)13-10-18(5-4-6-28-2)33(26,27)16-12(13)9-15(31-16)32(17,24)25/h9,13H,3-8,10-11H2,1-2H3,(H2,17,24,25)/t13-/m0/s1 |
| InChIKey | OUGKYIFTHVKSNE-ZDUSSCGKSA-N |
| XLogP | 0.27 |
| TPSA | 179.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|