2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid

C9H8N2O2 — CID 25067324

IUPAC2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid
SMILESO=C(O)Cc1c[nH]c2ncccc12
InChIInChI=1S/C9H8N2O2/c12-8(13)4-6-5-11-9-7(6)2-1-3-10-9/h1-3,5H,4H2,(H,10,11)(H,12,13)
InChIKeyNQHGQOVKJGGLKE-UHFFFAOYSA-N
MW176.18 g/mol
LogP1.19
Rot. Bonds2

About 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid

2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid (PubChem CID 25067324) has the molecular formula C9H8N2O2 and a molecular weight of 176.18 g/mol. Its IUPAC name is 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid.

Molecular Properties

Compound Name2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid
PubChem CID25067324
Molecular FormulaC9H8N2O2
Molecular Weight176.18 g/mol
Exact Mass176.06
IUPAC Name2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid
SMILESO=C(O)Cc1c[nH]c2ncccc12
InChIInChI=1S/C9H8N2O2/c12-8(13)4-6-5-11-9-7(6)2-1-3-10-9/h1-3,5H,4H2,(H,10,11)(H,12,13)
InChIKeyNQHGQOVKJGGLKE-UHFFFAOYSA-N
XLogP1.19
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.18
LogP ≤ 51.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid?
The IUPAC name of 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid (CID 25067324) is 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid.
What is the SMILES notation for 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid?
The canonical SMILES for 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid is O=C(O)Cc1c[nH]c2ncccc12.
What is the InChIKey of 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid?
The InChIKey is NQHGQOVKJGGLKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c12-8(13)4-6-5-11-9-7(6)2-1-3-10-9/h1-3,5H,4H2,(H,10,11)(H,12,13).
What are the key properties of 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid?
2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid has a molecular weight of 176.18 g/mol, XLogP of 1.19, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid is sourced from PubChem (CID 25067324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).