About 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid
2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid (PubChem CID 25067324) has the molecular formula C9H8N2O2
and a molecular weight of 176.18 g/mol. Its IUPAC name is 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid |
| PubChem CID | 25067324 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid |
| SMILES | O=C(O)Cc1c[nH]c2ncccc12 |
| InChI | InChI=1S/C9H8N2O2/c12-8(13)4-6-5-11-9-7(6)2-1-3-10-9/h1-3,5H,4H2,(H,10,11)(H,12,13) |
| InChIKey | NQHGQOVKJGGLKE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid?
The IUPAC name of 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid (CID 25067324) is 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid.
What is the SMILES notation for 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid?
The canonical SMILES for 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid is O=C(O)Cc1c[nH]c2ncccc12.
What is the InChIKey of 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid?
The InChIKey is NQHGQOVKJGGLKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c12-8(13)4-6-5-11-9-7(6)2-1-3-10-9/h1-3,5H,4H2,(H,10,11)(H,12,13).
What are the key properties of 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid?
2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid has a molecular weight of 176.18 g/mol, XLogP of 1.19, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid is sourced from PubChem (CID 25067324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).