About 2-chloro-3,4,5,6-tetrafluorobenzonitrile
2-chloro-3,4,5,6-tetrafluorobenzonitrile (PubChem CID 25067355) has the molecular formula C7ClF4N
and a molecular weight of 209.53 g/mol. Its IUPAC name is 2-chloro-3,4,5,6-tetrafluorobenzonitrile.
Molecular Properties
| Compound Name | 2-chloro-3,4,5,6-tetrafluorobenzonitrile |
| PubChem CID | 25067355 |
| Molecular Formula | C7ClF4N |
| Molecular Weight | 209.53 g/mol |
| Exact Mass | 208.97 |
| IUPAC Name | 2-chloro-3,4,5,6-tetrafluorobenzonitrile |
| SMILES | N#Cc1c(F)c(F)c(F)c(F)c1Cl |
| InChI | InChI=1S/C7ClF4N/c8-3-2(1-13)4(9)6(11)7(12)5(3)10 |
| InChIKey | DHLZPRHUUULMTP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3,4,5,6-tetrafluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3,4,5,6-tetrafluorobenzonitrile?
The IUPAC name of 2-chloro-3,4,5,6-tetrafluorobenzonitrile (CID 25067355) is 2-chloro-3,4,5,6-tetrafluorobenzonitrile.
What is the SMILES notation for 2-chloro-3,4,5,6-tetrafluorobenzonitrile?
The canonical SMILES for 2-chloro-3,4,5,6-tetrafluorobenzonitrile is N#Cc1c(F)c(F)c(F)c(F)c1Cl.
What is the InChIKey of 2-chloro-3,4,5,6-tetrafluorobenzonitrile?
The InChIKey is DHLZPRHUUULMTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7ClF4N/c8-3-2(1-13)4(9)6(11)7(12)5(3)10.
What are the key properties of 2-chloro-3,4,5,6-tetrafluorobenzonitrile?
2-chloro-3,4,5,6-tetrafluorobenzonitrile has a molecular weight of 209.53 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3,4,5,6-tetrafluorobenzonitrile is sourced from PubChem (CID 25067355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).