About 4-amino-2,6-diethylbenzonitrile
4-amino-2,6-diethylbenzonitrile (PubChem CID 25067369) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 4-amino-2,6-diethylbenzonitrile.
Molecular Properties
| Compound Name | 4-amino-2,6-diethylbenzonitrile |
| PubChem CID | 25067369 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 4-amino-2,6-diethylbenzonitrile |
| SMILES | CCc1cc(N)cc(CC)c1C#N |
| InChI | InChI=1S/C11H14N2/c1-3-8-5-10(13)6-9(4-2)11(8)7-12/h5-6H,3-4,13H2,1-2H3 |
| InChIKey | MEBZCJQSHLJQPC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2,6-diethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,6-diethylbenzonitrile?
The IUPAC name of 4-amino-2,6-diethylbenzonitrile (CID 25067369) is 4-amino-2,6-diethylbenzonitrile.
What is the SMILES notation for 4-amino-2,6-diethylbenzonitrile?
The canonical SMILES for 4-amino-2,6-diethylbenzonitrile is CCc1cc(N)cc(CC)c1C#N.
What is the InChIKey of 4-amino-2,6-diethylbenzonitrile?
The InChIKey is MEBZCJQSHLJQPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-3-8-5-10(13)6-9(4-2)11(8)7-12/h5-6H,3-4,13H2,1-2H3.
What are the key properties of 4-amino-2,6-diethylbenzonitrile?
4-amino-2,6-diethylbenzonitrile has a molecular weight of 174.25 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,6-diethylbenzonitrile is sourced from PubChem (CID 25067369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).