C32H39N3O3 — CID 25067445
1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[2-(3-hydroxypropylamino)-6-phenylbenzimidazol-1-yl]ethanone (PubChem CID 25067445) has the molecular formula C32H39N3O3 and a molecular weight of 513.68 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[2-(3-hydroxypropylamino)-6-phenylbenzimidazol-1-yl]ethanone.
| Compound Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[2-(3-hydroxypropylamino)-6-phenylbenzimidazol-1-yl]ethanone |
|---|---|
| PubChem CID | 25067445 |
| Molecular Formula | C32H39N3O3 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[2-(3-hydroxypropylamino)-6-phenylbenzimidazol-1-yl]ethanone |
| SMILES | CC(C)(C)c1cc(C(=O)Cn2c(NCCCO)nc3ccc(-c4ccccc4)cc32)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C32H39N3O3/c1-31(2,3)24-17-23(18-25(29(24)38)32(4,5)6)28(37)20-35-27-19-22(21-11-8-7-9-12-21)13-14-26(27)34-30(35)33-15-10-16-36/h7-9,11-14,17-19,36,38H,10,15-16,20H2,1-6H3,(H,33,34) |
| InChIKey | SCDSFTUJVQFLHO-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|