C25H38N2O2 — CID 25067516
(2R)-2-(9-imidazol-1-ylnonyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol (PubChem CID 25067516) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is (2R)-2-(9-imidazol-1-ylnonyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol.
| Compound Name | (2R)-2-(9-imidazol-1-ylnonyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 25067516 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | (2R)-2-(9-imidazol-1-ylnonyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)CC[C@@](C)(CCCCCCCCCn1ccnc1)O2 |
| InChI | InChI=1S/C25H38N2O2/c1-19-20(2)24-22(21(3)23(19)28)12-14-25(4,29-24)13-10-8-6-5-7-9-11-16-27-17-15-26-18-27/h15,17-18,28H,5-14,16H2,1-4H3/t25-/m1/s1 |
| InChIKey | MLGXSNGGDPGAOF-RUZDIDTESA-N |
| XLogP | 6.42 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|