C24H21ClN2O4 — CID 25067949
1-(4-chlorophenyl)-7,7-dimethyl-3-[(3-nitrophenyl)methyl]-6,8-dihydroquinoline-2,5-dione (PubChem CID 25067949) has the molecular formula C24H21ClN2O4 and a molecular weight of 436.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-7,7-dimethyl-3-[(3-nitrophenyl)methyl]-6,8-dihydroquinoline-2,5-dione.
| Compound Name | 1-(4-chlorophenyl)-7,7-dimethyl-3-[(3-nitrophenyl)methyl]-6,8-dihydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 25067949 |
| Molecular Formula | C24H21ClN2O4 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 1-(4-chlorophenyl)-7,7-dimethyl-3-[(3-nitrophenyl)methyl]-6,8-dihydroquinoline-2,5-dione |
| SMILES | CC1(C)CC(=O)c2cc(Cc3cccc([N+](=O)[O-])c3)c(=O)n(-c3ccc(Cl)cc3)c2C1 |
| InChI | InChI=1S/C24H21ClN2O4/c1-24(2)13-21-20(22(28)14-24)12-16(10-15-4-3-5-19(11-15)27(30)31)23(29)26(21)18-8-6-17(25)7-9-18/h3-9,11-12H,10,13-14H2,1-2H3 |
| InChIKey | BPRWMBITOTWSOQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 82.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|