C30H16N12 — CID 25068014
3-[1,2,2-tris(1,2,4-benzotriazin-3-yl)ethenyl]-1,2,4-benzotriazine (PubChem CID 25068014) has the molecular formula C30H16N12 and a molecular weight of 544.54 g/mol. Its IUPAC name is 3-[1,2,2-tris(1,2,4-benzotriazin-3-yl)ethenyl]-1,2,4-benzotriazine.
| Compound Name | 3-[1,2,2-tris(1,2,4-benzotriazin-3-yl)ethenyl]-1,2,4-benzotriazine |
|---|---|
| PubChem CID | 25068014 |
| Molecular Formula | C30H16N12 |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | 3-[1,2,2-tris(1,2,4-benzotriazin-3-yl)ethenyl]-1,2,4-benzotriazine |
| SMILES | c1ccc2nc(C(=C(c3nnc4ccccc4n3)c3nnc4ccccc4n3)c3nnc4ccccc4n3)nnc2c1 |
| InChI | InChI=1S/C30H16N12/c1-5-13-21-17(9-1)31-27(39-35-21)25(28-32-18-10-2-6-14-22(18)36-40-28)26(29-33-19-11-3-7-15-23(19)37-41-29)30-34-20-12-4-8-16-24(20)38-42-30/h1-16H |
| InChIKey | CLQNDYHOQCDEEH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 154.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |