C20H23F2N3O4 — CID 25068093
methyl (1R,5S)-8-(2-acetamidoethylcarbamoyl)-3-(2,4-difluorophenyl)-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate (PubChem CID 25068093) has the molecular formula C20H23F2N3O4 and a molecular weight of 407.42 g/mol. Its IUPAC name is methyl (1R,5S)-8-(2-acetamidoethylcarbamoyl)-3-(2,4-difluorophenyl)-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate.
| Compound Name | methyl (1R,5S)-8-(2-acetamidoethylcarbamoyl)-3-(2,4-difluorophenyl)-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 25068093 |
| Molecular Formula | C20H23F2N3O4 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | methyl (1R,5S)-8-(2-acetamidoethylcarbamoyl)-3-(2,4-difluorophenyl)-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylate |
| SMILES | COC(=O)C1=C(c2ccc(F)cc2F)C[C@@H]2CC[C@H]1N2C(=O)NCCNC(C)=O |
| InChI | InChI=1S/C20H23F2N3O4/c1-11(26)23-7-8-24-20(28)25-13-4-6-17(25)18(19(27)29-2)15(10-13)14-5-3-12(21)9-16(14)22/h3,5,9,13,17H,4,6-8,10H2,1-2H3,(H,23,26)(H,24,28)/t13-,17+/m0/s1 |
| InChIKey | ZNNPSZCYUHZRFN-SUMWQHHRSA-N |
| XLogP | 1.97 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|