C32H30O10 — CID 25068119
2,4,6,7,9,11-hexamethoxy-1,12-bis(2-oxopropyl)perylene-3,10-dione (PubChem CID 25068119) has the molecular formula C32H30O10 and a molecular weight of 574.58 g/mol. Its IUPAC name is 2,4,6,7,9,11-hexamethoxy-1,12-bis(2-oxopropyl)perylene-3,10-dione.
| Compound Name | 2,4,6,7,9,11-hexamethoxy-1,12-bis(2-oxopropyl)perylene-3,10-dione |
|---|---|
| PubChem CID | 25068119 |
| Molecular Formula | C32H30O10 |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | 2,4,6,7,9,11-hexamethoxy-1,12-bis(2-oxopropyl)perylene-3,10-dione |
| SMILES | COc1c(CC(C)=O)c2c3c(CC(C)=O)c(OC)c(=O)c4c(OC)cc(OC)c(c5c(OC)cc(OC)c(c1=O)c52)c43 |
| InChI | InChI=1S/C32H30O10/c1-13(33)9-15-21-22-16(10-14(2)34)32(42-8)30(36)26-20(40-6)12-18(38-4)24(28(22)26)23-17(37-3)11-19(39-5)25(27(21)23)29(35)31(15)41-7/h11-12H,9-10H2,1-8H3 |
| InChIKey | NJFBDPJCCXTORI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|