C31H48O3S4Si — CID 25068345
(1R,6Z)-1-[2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(2-methyl-1,3-dithian-2-yl)propyl]-1,3-dithian-2-yl]-1,4,5,8-tetrahydro-2-benzoxecin-3-one (PubChem CID 25068345) has the molecular formula C31H48O3S4Si and a molecular weight of 625.08 g/mol. Its IUPAC name is (1R,6Z)-1-[2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(2-methyl-1,3-dithian-2-yl)propyl]-1,3-dithian-2-yl]-1,4,5,8-tetrahydro-2-benzoxecin-3-one.
| Compound Name | (1R,6Z)-1-[2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(2-methyl-1,3-dithian-2-yl)propyl]-1,3-dithian-2-yl]-1,4,5,8-tetrahydro-2-benzoxecin-3-one |
|---|---|
| PubChem CID | 25068345 |
| Molecular Formula | C31H48O3S4Si |
| Molecular Weight | 625.08 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | (1R,6Z)-1-[2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(2-methyl-1,3-dithian-2-yl)propyl]-1,3-dithian-2-yl]-1,4,5,8-tetrahydro-2-benzoxecin-3-one |
| SMILES | CC1(C[C@H](CC2([C@@H]3OC(=O)CC/C=C\Cc4ccccc43)SCCCS2)O[Si](C)(C)C(C)(C)C)SCCCS1 |
| InChI | InChI=1S/C31H48O3S4Si/c1-29(2,3)39(5,6)34-25(22-30(4)35-18-12-19-36-30)23-31(37-20-13-21-38-31)28-26-16-11-10-15-24(26)14-8-7-9-17-27(32)33-28/h7-8,10-11,15-16,25,28H,9,12-14,17-23H2,1-6H3/b8-7-/t25-,28-/m1/s1 |
| InChIKey | WBQVIGQENBTQCK-XWFBATHESA-N |
| XLogP | 9.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.08 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|