C23H27N3O3 — CID 25068966
6-[3-[4-(2,3-dihydro-1-benzofuran-4-yl)piperazin-1-yl]propoxy]-2,3-dihydroisoindol-1-one (PubChem CID 25068966) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 6-[3-[4-(2,3-dihydro-1-benzofuran-4-yl)piperazin-1-yl]propoxy]-2,3-dihydroisoindol-1-one.
| Compound Name | 6-[3-[4-(2,3-dihydro-1-benzofuran-4-yl)piperazin-1-yl]propoxy]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 25068966 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 6-[3-[4-(2,3-dihydro-1-benzofuran-4-yl)piperazin-1-yl]propoxy]-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2ccc(OCCCN3CCN(c4cccc5c4CCO5)CC3)cc21 |
| InChI | InChI=1S/C23H27N3O3/c27-23-20-15-18(6-5-17(20)16-24-23)28-13-2-8-25-9-11-26(12-10-25)21-3-1-4-22-19(21)7-14-29-22/h1,3-6,15H,2,7-14,16H2,(H,24,27) |
| InChIKey | LQUKOEAHGRXJMZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|