C25H25F2N3O2 — CID 25069015
6-[3-[4-(6,7-difluoronaphthalen-1-yl)piperazin-1-yl]propoxy]-2,3-dihydroisoindol-1-one (PubChem CID 25069015) has the molecular formula C25H25F2N3O2 and a molecular weight of 437.49 g/mol. Its IUPAC name is 6-[3-[4-(6,7-difluoronaphthalen-1-yl)piperazin-1-yl]propoxy]-2,3-dihydroisoindol-1-one.
| Compound Name | 6-[3-[4-(6,7-difluoronaphthalen-1-yl)piperazin-1-yl]propoxy]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 25069015 |
| Molecular Formula | C25H25F2N3O2 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 6-[3-[4-(6,7-difluoronaphthalen-1-yl)piperazin-1-yl]propoxy]-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2ccc(OCCCN3CCN(c4cccc5cc(F)c(F)cc45)CC3)cc21 |
| InChI | InChI=1S/C25H25F2N3O2/c26-22-13-17-3-1-4-24(20(17)15-23(22)27)30-10-8-29(9-11-30)7-2-12-32-19-6-5-18-16-28-25(31)21(18)14-19/h1,3-6,13-15H,2,7-12,16H2,(H,28,31) |
| InChIKey | AXOOPBWOJVOGHK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|