C21H27N5 — CID 25069405
6-N-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4,6-diamine (PubChem CID 25069405) has the molecular formula C21H27N5 and a molecular weight of 349.48 g/mol. Its IUPAC name is 6-N-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4,6-diamine.
| Compound Name | 6-N-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4,6-diamine |
|---|---|
| PubChem CID | 25069405 |
| Molecular Formula | C21H27N5 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 6-N-[(1R,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4,6-diamine |
| SMILES | CN1[C@@H]2CC[C@@H]1CC(Nc1nc(N)nc3c1CCCc1ccccc1-3)C2 |
| InChI | InChI=1S/C21H27N5/c1-26-15-9-10-16(26)12-14(11-15)23-20-18-8-4-6-13-5-2-3-7-17(13)19(18)24-21(22)25-20/h2-3,5,7,14-16H,4,6,8-12H2,1H3,(H3,22,23,24,25)/t15-,16-/m1/s1 |
| InChIKey | NSRIZNCCNYMWLC-HZPDHXFCSA-N |
| XLogP | 3.25 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |