C21H25F3N6O3 — CID 25069541
6-amino-9-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-2-(4,4,4-trifluorobutoxy)-7H-purin-8-one (PubChem CID 25069541) has the molecular formula C21H25F3N6O3 and a molecular weight of 466.46 g/mol. Its IUPAC name is 6-amino-9-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-2-(4,4,4-trifluorobutoxy)-7H-purin-8-one.
| Compound Name | 6-amino-9-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-2-(4,4,4-trifluorobutoxy)-7H-purin-8-one |
|---|---|
| PubChem CID | 25069541 |
| Molecular Formula | C21H25F3N6O3 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 6-amino-9-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-2-(4,4,4-trifluorobutoxy)-7H-purin-8-one |
| SMILES | Nc1nc(OCCCC(F)(F)F)nc2c1[nH]c(=O)n2Cc1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C21H25F3N6O3/c22-21(23,24)6-1-9-33-19-27-17(25)16-18(28-19)30(20(31)26-16)13-15-4-2-14(3-5-15)12-29-7-10-32-11-8-29/h2-5H,1,6-13H2,(H,26,31)(H2,25,27,28) |
| InChIKey | VWZHKUZEPRZCGA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|