C22H28F3N7O2 — CID 25069542
6-amino-9-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-2-(4,4,4-trifluorobutoxy)-7H-purin-8-one (PubChem CID 25069542) has the molecular formula C22H28F3N7O2 and a molecular weight of 479.51 g/mol. Its IUPAC name is 6-amino-9-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-2-(4,4,4-trifluorobutoxy)-7H-purin-8-one.
| Compound Name | 6-amino-9-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-2-(4,4,4-trifluorobutoxy)-7H-purin-8-one |
|---|---|
| PubChem CID | 25069542 |
| Molecular Formula | C22H28F3N7O2 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 6-amino-9-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-2-(4,4,4-trifluorobutoxy)-7H-purin-8-one |
| SMILES | CN1CCN(Cc2ccc(Cn3c(=O)[nH]c4c(N)nc(OCCCC(F)(F)F)nc43)cc2)CC1 |
| InChI | InChI=1S/C22H28F3N7O2/c1-30-8-10-31(11-9-30)13-15-3-5-16(6-4-15)14-32-19-17(27-21(32)33)18(26)28-20(29-19)34-12-2-7-22(23,24)25/h3-6H,2,7-14H2,1H3,(H,27,33)(H2,26,28,29) |
| InChIKey | SNKZRBOPRROCKY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|