C21H27F3N6O3 — CID 25069543
6-amino-9-[[4-[[2-methoxyethyl(methyl)amino]methyl]phenyl]methyl]-2-(4,4,4-trifluorobutoxy)-7H-purin-8-one (PubChem CID 25069543) has the molecular formula C21H27F3N6O3 and a molecular weight of 468.48 g/mol. Its IUPAC name is 6-amino-9-[[4-[[2-methoxyethyl(methyl)amino]methyl]phenyl]methyl]-2-(4,4,4-trifluorobutoxy)-7H-purin-8-one.
| Compound Name | 6-amino-9-[[4-[[2-methoxyethyl(methyl)amino]methyl]phenyl]methyl]-2-(4,4,4-trifluorobutoxy)-7H-purin-8-one |
|---|---|
| PubChem CID | 25069543 |
| Molecular Formula | C21H27F3N6O3 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 6-amino-9-[[4-[[2-methoxyethyl(methyl)amino]methyl]phenyl]methyl]-2-(4,4,4-trifluorobutoxy)-7H-purin-8-one |
| SMILES | COCCN(C)Cc1ccc(Cn2c(=O)[nH]c3c(N)nc(OCCCC(F)(F)F)nc32)cc1 |
| InChI | InChI=1S/C21H27F3N6O3/c1-29(9-11-32-2)12-14-4-6-15(7-5-14)13-30-18-16(26-20(30)31)17(25)27-19(28-18)33-10-3-8-21(22,23)24/h4-7H,3,8-13H2,1-2H3,(H,26,31)(H2,25,27,28) |
| InChIKey | UJJMTBUEZOULOF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|