C22H29N5O2S — CID 25069567
1-[2-(2,2-dimethylpropylamino)ethyl]-2-[(6-ethyl-1,3-benzodioxol-5-yl)sulfanyl]imidazo[4,5-c]pyridin-4-amine (PubChem CID 25069567) has the molecular formula C22H29N5O2S and a molecular weight of 427.57 g/mol. Its IUPAC name is 1-[2-(2,2-dimethylpropylamino)ethyl]-2-[(6-ethyl-1,3-benzodioxol-5-yl)sulfanyl]imidazo[4,5-c]pyridin-4-amine.
| Compound Name | 1-[2-(2,2-dimethylpropylamino)ethyl]-2-[(6-ethyl-1,3-benzodioxol-5-yl)sulfanyl]imidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 25069567 |
| Molecular Formula | C22H29N5O2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 1-[2-(2,2-dimethylpropylamino)ethyl]-2-[(6-ethyl-1,3-benzodioxol-5-yl)sulfanyl]imidazo[4,5-c]pyridin-4-amine |
| SMILES | CCc1cc2c(cc1Sc1nc3c(N)nccc3n1CCNCC(C)(C)C)OCO2 |
| InChI | InChI=1S/C22H29N5O2S/c1-5-14-10-16-17(29-13-28-16)11-18(14)30-21-26-19-15(6-7-25-20(19)23)27(21)9-8-24-12-22(2,3)4/h6-7,10-11,24H,5,8-9,12-13H2,1-4H3,(H2,23,25) |
| InChIKey | LBHSRWKOIDOUDS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|