C24H30N8OS — CID 25069576
N-[4-[4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]sulfanylphenyl]propanamide (PubChem CID 25069576) has the molecular formula C24H30N8OS and a molecular weight of 478.63 g/mol. Its IUPAC name is N-[4-[4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]sulfanylphenyl]propanamide.
| Compound Name | N-[4-[4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]sulfanylphenyl]propanamide |
|---|---|
| PubChem CID | 25069576 |
| Molecular Formula | C24H30N8OS |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | N-[4-[4-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]sulfanylphenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(Sc2nc(Nc3cc(C)[nH]n3)cc(N3CC4CCCNC4C3)n2)cc1 |
| InChI | InChI=1S/C24H30N8OS/c1-3-23(33)26-17-6-8-18(9-7-17)34-24-28-20(27-21-11-15(2)30-31-21)12-22(29-24)32-13-16-5-4-10-25-19(16)14-32/h6-9,11-12,16,19,25H,3-5,10,13-14H2,1-2H3,(H,26,33)(H2,27,28,29,30,31) |
| InChIKey | PHTBTLMZFXENCK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |