C25H19N3O4 — CID 25070295
16,17-dihydroxy-4,14,20-triazaheptacyclo[12.12.2.02,6.07,28.08,13.020,27.021,26]octacosa-1,6,8,10,12,21,23,25,27-nonaene-3,5-dione (PubChem CID 25070295) has the molecular formula C25H19N3O4 and a molecular weight of 425.44 g/mol. Its IUPAC name is 16,17-dihydroxy-4,14,20-triazaheptacyclo[12.12.2.02,6.07,28.08,13.020,27.021,26]octacosa-1,6,8,10,12,21,23,25,27-nonaene-3,5-dione.
| Compound Name | 16,17-dihydroxy-4,14,20-triazaheptacyclo[12.12.2.02,6.07,28.08,13.020,27.021,26]octacosa-1,6,8,10,12,21,23,25,27-nonaene-3,5-dione |
|---|---|
| PubChem CID | 25070295 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 16,17-dihydroxy-4,14,20-triazaheptacyclo[12.12.2.02,6.07,28.08,13.020,27.021,26]octacosa-1,6,8,10,12,21,23,25,27-nonaene-3,5-dione |
| SMILES | O=C1NC(=O)c2c1c1c3ccccc3n3c1c1c2c2ccccc2n1CC(O)C(O)CC3 |
| InChI | InChI=1S/C25H19N3O4/c29-16-9-10-27-14-7-3-1-5-12(14)18-20-21(25(32)26-24(20)31)19-13-6-2-4-8-15(13)28(11-17(16)30)23(19)22(18)27/h1-8,16-17,29-30H,9-11H2,(H,26,31,32) |
| InChIKey | UVJFVMZVICCYGP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|