C24H17N3O3 — CID 25070297
(16Z)-16,17-dihydroxy-4,14,19-triazaheptacyclo[12.11.2.02,6.07,27.08,13.019,26.020,25]heptacosa-1,6,8,10,12,16,20,22,24,26-decaen-3-one (PubChem CID 25070297) has the molecular formula C24H17N3O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is (16Z)-16,17-dihydroxy-4,14,19-triazaheptacyclo[12.11.2.02,6.07,27.08,13.019,26.020,25]heptacosa-1,6,8,10,12,16,20,22,24,26-decaen-3-one.
| Compound Name | (16Z)-16,17-dihydroxy-4,14,19-triazaheptacyclo[12.11.2.02,6.07,27.08,13.019,26.020,25]heptacosa-1,6,8,10,12,16,20,22,24,26-decaen-3-one |
|---|---|
| PubChem CID | 25070297 |
| Molecular Formula | C24H17N3O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | (16Z)-16,17-dihydroxy-4,14,19-triazaheptacyclo[12.11.2.02,6.07,27.08,13.019,26.020,25]heptacosa-1,6,8,10,12,16,20,22,24,26-decaen-3-one |
| SMILES | O=C1NCc2c1c1c3ccccc3n3c1c1c2c2ccccc2n1C/C(O)=C(/O)C3 |
| InChI | InChI=1S/C24H17N3O3/c28-17-10-26-15-7-3-1-5-12(15)19-14-9-25-24(30)21(14)20-13-6-2-4-8-16(13)27(11-18(17)29)23(20)22(19)26/h1-8,28-29H,9-11H2,(H,25,30)/b18-17- |
| InChIKey | XHIZBVRTHPYLJI-ZCXUNETKSA-N |
| XLogP | 4.49 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |