C25H28N3O4+ — CID 25070412
17-methoxy-N-(2-morpholin-4-ylethyl)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-amine (PubChem CID 25070412) has the molecular formula C25H28N3O4+ and a molecular weight of 434.52 g/mol. Its IUPAC name is 17-methoxy-N-(2-morpholin-4-ylethyl)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-amine.
| Compound Name | 17-methoxy-N-(2-morpholin-4-ylethyl)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-amine |
|---|---|
| PubChem CID | 25070412 |
| Molecular Formula | C25H28N3O4+ |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 17-methoxy-N-(2-morpholin-4-ylethyl)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-amine |
| SMILES | COc1ccc2cc3[n+](cc2c1NCCN1CCOCC1)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C25H27N3O4/c1-29-22-3-2-17-12-21-19-14-24-23(31-16-32-24)13-18(19)4-6-28(21)15-20(17)25(22)26-5-7-27-8-10-30-11-9-27/h2-3,12-15H,4-11,16H2,1H3/p+1 |
| InChIKey | CUBWHZMEUVXQSG-UHFFFAOYSA-O |
| XLogP | 2.83 |
| TPSA | 56.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|