C22H33N9O — CID 25070828
6-amino-2-(butylamino)-9-[[6-[4-(dimethylamino)piperidin-1-yl]-3-pyridinyl]methyl]-7H-purin-8-one (PubChem CID 25070828) has the molecular formula C22H33N9O and a molecular weight of 439.57 g/mol. Its IUPAC name is 6-amino-2-(butylamino)-9-[[6-[4-(dimethylamino)piperidin-1-yl]-3-pyridinyl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-(butylamino)-9-[[6-[4-(dimethylamino)piperidin-1-yl]-3-pyridinyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 25070828 |
| Molecular Formula | C22H33N9O |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | 6-amino-2-(butylamino)-9-[[6-[4-(dimethylamino)piperidin-1-yl]-3-pyridinyl]methyl]-7H-purin-8-one |
| SMILES | CCCCNc1nc(N)c2[nH]c(=O)n(Cc3ccc(N4CCC(N(C)C)CC4)nc3)c2n1 |
| InChI | InChI=1S/C22H33N9O/c1-4-5-10-24-21-27-19(23)18-20(28-21)31(22(32)26-18)14-15-6-7-17(25-13-15)30-11-8-16(9-12-30)29(2)3/h6-7,13,16H,4-5,8-12,14H2,1-3H3,(H,26,32)(H3,23,24,27,28) |
| InChIKey | JCXFUFGKTZEQLI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 120.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|