C25H28FN3O2S — CID 25070947
(E)-2-[(8R)-8-[(3-fluorophenyl)methyl]-1,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-yl]-N-[(1S)-1-phenylethyl]ethenesulfonamide (PubChem CID 25070947) has the molecular formula C25H28FN3O2S and a molecular weight of 453.58 g/mol. Its IUPAC name is (E)-2-[(8R)-8-[(3-fluorophenyl)methyl]-1,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-yl]-N-[(1S)-1-phenylethyl]ethenesulfonamide.
| Compound Name | (E)-2-[(8R)-8-[(3-fluorophenyl)methyl]-1,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-yl]-N-[(1S)-1-phenylethyl]ethenesulfonamide |
|---|---|
| PubChem CID | 25070947 |
| Molecular Formula | C25H28FN3O2S |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | (E)-2-[(8R)-8-[(3-fluorophenyl)methyl]-1,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-yl]-N-[(1S)-1-phenylethyl]ethenesulfonamide |
| SMILES | C[C@H](NS(=O)(=O)/C=C/c1n[nH]c2c1CCCC[C@@H]2Cc1cccc(F)c1)c1ccccc1 |
| InChI | InChI=1S/C25H28FN3O2S/c1-18(20-9-3-2-4-10-20)29-32(30,31)15-14-24-23-13-6-5-11-21(25(23)28-27-24)16-19-8-7-12-22(26)17-19/h2-4,7-10,12,14-15,17-18,21,29H,5-6,11,13,16H2,1H3,(H,27,28)/b15-14+/t18-,21+/m0/s1 |
| InChIKey | ZJNQGLZHOIOWFU-SGERCBKXSA-N |
| XLogP | 5.25 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |