C19H19IN4O2S — CID 25071179
2-(2-iodo-4,5-dimethoxyphenyl)sulfanyl-1-pent-4-ynylimidazo[4,5-c]pyridin-4-amine (PubChem CID 25071179) has the molecular formula C19H19IN4O2S and a molecular weight of 494.36 g/mol. Its IUPAC name is 2-(2-iodo-4,5-dimethoxyphenyl)sulfanyl-1-pent-4-ynylimidazo[4,5-c]pyridin-4-amine.
| Compound Name | 2-(2-iodo-4,5-dimethoxyphenyl)sulfanyl-1-pent-4-ynylimidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 25071179 |
| Molecular Formula | C19H19IN4O2S |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 2-(2-iodo-4,5-dimethoxyphenyl)sulfanyl-1-pent-4-ynylimidazo[4,5-c]pyridin-4-amine |
| SMILES | C#CCCCn1c(Sc2cc(OC)c(OC)cc2I)nc2c(N)nccc21 |
| InChI | InChI=1S/C19H19IN4O2S/c1-4-5-6-9-24-13-7-8-22-18(21)17(13)23-19(24)27-16-11-15(26-3)14(25-2)10-12(16)20/h1,7-8,10-11H,5-6,9H2,2-3H3,(H2,21,22) |
| InChIKey | BNKIQGGWXUYGKY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|