C22H15ClF3N7 — CID 25071291
N-[(1S)-1-[3-(2-chlorophenyl)-5-(trifluoromethyl)quinoxalin-2-yl]ethyl]-7H-purin-6-amine (PubChem CID 25071291) has the molecular formula C22H15ClF3N7 and a molecular weight of 469.86 g/mol. Its IUPAC name is N-[(1S)-1-[3-(2-chlorophenyl)-5-(trifluoromethyl)quinoxalin-2-yl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[(1S)-1-[3-(2-chlorophenyl)-5-(trifluoromethyl)quinoxalin-2-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 25071291 |
| Molecular Formula | C22H15ClF3N7 |
| Molecular Weight | 469.86 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | N-[(1S)-1-[3-(2-chlorophenyl)-5-(trifluoromethyl)quinoxalin-2-yl]ethyl]-7H-purin-6-amine |
| SMILES | C[C@H](Nc1ncnc2nc[nH]c12)c1nc2cccc(C(F)(F)F)c2nc1-c1ccccc1Cl |
| InChI | InChI=1S/C22H15ClF3N7/c1-11(31-21-19-20(28-9-27-19)29-10-30-21)16-17(12-5-2-3-7-14(12)23)33-18-13(22(24,25)26)6-4-8-15(18)32-16/h2-11H,1H3,(H2,27,28,29,30,31)/t11-/m0/s1 |
| InChIKey | WVQMBZKXBLQNLQ-NSHDSACASA-N |
| XLogP | 5.81 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.86 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |