About N-[[8-chloro-2-(3,5-difluorophenyl)quinolin-3-yl]methyl]-7H-purin-6-amine
N-[[8-chloro-2-(3,5-difluorophenyl)quinolin-3-yl]methyl]-7H-purin-6-amine (PubChem CID 25071606) has the molecular formula C21H13ClF2N6
and a molecular weight of 422.83 g/mol. Its IUPAC name is N-[[8-chloro-2-(3,5-difluorophenyl)quinolin-3-yl]methyl]-7H-purin-6-amine.
Molecular Properties
| Compound Name | N-[[8-chloro-2-(3,5-difluorophenyl)quinolin-3-yl]methyl]-7H-purin-6-amine |
| PubChem CID | 25071606 |
| Molecular Formula | C21H13ClF2N6 |
| Molecular Weight | 422.83 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-[[8-chloro-2-(3,5-difluorophenyl)quinolin-3-yl]methyl]-7H-purin-6-amine |
| SMILES | Fc1cc(F)cc(-c2nc3c(Cl)cccc3cc2CNc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C21H13ClF2N6/c22-16-3-1-2-11-4-13(8-25-20-19-21(27-9-26-19)29-10-28-20)17(30-18(11)16)12-5-14(23)7-15(24)6-12/h1-7,9-10H,8H2,(H2,25,26,27,28,29) |
| InChIKey | ZHWWDWCWGLEXOV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.83 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[8-chloro-2-(3,5-difluorophenyl)quinolin-3-yl]methyl]-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[8-chloro-2-(3,5-difluorophenyl)quinolin-3-yl]methyl]-7H-purin-6-amine?
The IUPAC name of N-[[8-chloro-2-(3,5-difluorophenyl)quinolin-3-yl]methyl]-7H-purin-6-amine (CID 25071606) is N-[[8-chloro-2-(3,5-difluorophenyl)quinolin-3-yl]methyl]-7H-purin-6-amine.
What is the SMILES notation for N-[[8-chloro-2-(3,5-difluorophenyl)quinolin-3-yl]methyl]-7H-purin-6-amine?
The canonical SMILES for N-[[8-chloro-2-(3,5-difluorophenyl)quinolin-3-yl]methyl]-7H-purin-6-amine is Fc1cc(F)cc(-c2nc3c(Cl)cccc3cc2CNc2ncnc3nc[nH]c23)c1.
What is the InChIKey of N-[[8-chloro-2-(3,5-difluorophenyl)quinolin-3-yl]methyl]-7H-purin-6-amine?
The InChIKey is ZHWWDWCWGLEXOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13ClF2N6/c22-16-3-1-2-11-4-13(8-25-20-19-21(27-9-26-19)29-10-28-20)17(30-18(11)16)12-5-14(23)7-15(24)6-12/h1-7,9-10H,8H2,(H2,25,26,27,28,29).
What are the key properties of N-[[8-chloro-2-(3,5-difluorophenyl)quinolin-3-yl]methyl]-7H-purin-6-amine?
N-[[8-chloro-2-(3,5-difluorophenyl)quinolin-3-yl]methyl]-7H-purin-6-amine has a molecular weight of 422.83 g/mol, XLogP of 5.11, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[8-chloro-2-(3,5-difluorophenyl)quinolin-3-yl]methyl]-7H-purin-6-amine is sourced from PubChem (CID 25071606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).