C22H25Cl2N5O2 — CID 25071691
(NE)-N-[[5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridin-3-yl]methylidene]hydroxylamine (PubChem CID 25071691) has the molecular formula C22H25Cl2N5O2 and a molecular weight of 462.38 g/mol. Its IUPAC name is (NE)-N-[[5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridin-3-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridin-3-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 25071691 |
| Molecular Formula | C22H25Cl2N5O2 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | (NE)-N-[[5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridin-3-yl]methylidene]hydroxylamine |
| SMILES | O/N=C/c1cnn2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc12 |
| InChI | InChI=1S/C22H25Cl2N5O2/c23-19-4-3-5-20(22(19)24)28-11-9-27(10-12-28)7-1-2-13-31-18-6-8-29-21(14-18)17(15-25-29)16-26-30/h3-6,8,14-16,30H,1-2,7,9-13H2/b26-16+ |
| InChIKey | DWMNREQVNSYYID-WGOQTCKBSA-N |
| XLogP | 4.43 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|