C22H19F2N5O2S3 — CID 25071855
N-[[(4R)-3-[5-(3,4-difluorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-1,3-thiazolidin-4-yl]methyl]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide (PubChem CID 25071855) has the molecular formula C22H19F2N5O2S3 and a molecular weight of 519.62 g/mol. Its IUPAC name is N-[[(4R)-3-[5-(3,4-difluorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-1,3-thiazolidin-4-yl]methyl]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide.
| Compound Name | N-[[(4R)-3-[5-(3,4-difluorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-1,3-thiazolidin-4-yl]methyl]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 25071855 |
| Molecular Formula | C22H19F2N5O2S3 |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | N-[[(4R)-3-[5-(3,4-difluorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-1,3-thiazolidin-4-yl]methyl]-6-methylimidazo[2,1-b][1,3]thiazole-5-carboxamide |
| SMILES | Cc1nc(C(=O)N2CSC[C@H]2CNC(=O)c2c(C)nc3sccn23)c(-c2ccc(F)c(F)c2)s1 |
| InChI | InChI=1S/C22H19F2N5O2S3/c1-11-18(28-5-6-33-22(28)26-11)20(30)25-8-14-9-32-10-29(14)21(31)17-19(34-12(2)27-17)13-3-4-15(23)16(24)7-13/h3-7,14H,8-10H2,1-2H3,(H,25,30)/t14-/m1/s1 |
| InChIKey | RUVQRHOWIGBERO-CQSZACIVSA-N |
| XLogP | 4.36 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |