About 4-[[5-fluoro-4-[3-(1,3-oxazol-2-yl)anilino]pyrimidin-2-yl]amino]benzamide
4-[[5-fluoro-4-[3-(1,3-oxazol-2-yl)anilino]pyrimidin-2-yl]amino]benzamide (PubChem CID 25071925) has the molecular formula C20H15FN6O2
and a molecular weight of 390.38 g/mol. Its IUPAC name is 4-[[5-fluoro-4-[3-(1,3-oxazol-2-yl)anilino]pyrimidin-2-yl]amino]benzamide.
Molecular Properties
| Compound Name | 4-[[5-fluoro-4-[3-(1,3-oxazol-2-yl)anilino]pyrimidin-2-yl]amino]benzamide |
| PubChem CID | 25071925 |
| Molecular Formula | C20H15FN6O2 |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4-[[5-fluoro-4-[3-(1,3-oxazol-2-yl)anilino]pyrimidin-2-yl]amino]benzamide |
| SMILES | NC(=O)c1ccc(Nc2ncc(F)c(Nc3cccc(-c4ncco4)c3)n2)cc1 |
| InChI | InChI=1S/C20H15FN6O2/c21-16-11-24-20(26-14-6-4-12(5-7-14)17(22)28)27-18(16)25-15-3-1-2-13(10-15)19-23-8-9-29-19/h1-11H,(H2,22,28)(H2,24,25,26,27) |
| InChIKey | KPDSYXOQCSZKOC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[5-fluoro-4-[3-(1,3-oxazol-2-yl)anilino]pyrimidin-2-yl]amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-fluoro-4-[3-(1,3-oxazol-2-yl)anilino]pyrimidin-2-yl]amino]benzamide?
The IUPAC name of 4-[[5-fluoro-4-[3-(1,3-oxazol-2-yl)anilino]pyrimidin-2-yl]amino]benzamide (CID 25071925) is 4-[[5-fluoro-4-[3-(1,3-oxazol-2-yl)anilino]pyrimidin-2-yl]amino]benzamide.
What is the SMILES notation for 4-[[5-fluoro-4-[3-(1,3-oxazol-2-yl)anilino]pyrimidin-2-yl]amino]benzamide?
The canonical SMILES for 4-[[5-fluoro-4-[3-(1,3-oxazol-2-yl)anilino]pyrimidin-2-yl]amino]benzamide is NC(=O)c1ccc(Nc2ncc(F)c(Nc3cccc(-c4ncco4)c3)n2)cc1.
What is the InChIKey of 4-[[5-fluoro-4-[3-(1,3-oxazol-2-yl)anilino]pyrimidin-2-yl]amino]benzamide?
The InChIKey is KPDSYXOQCSZKOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15FN6O2/c21-16-11-24-20(26-14-6-4-12(5-7-14)17(22)28)27-18(16)25-15-3-1-2-13(10-15)19-23-8-9-29-19/h1-11H,(H2,22,28)(H2,24,25,26,27).
What are the key properties of 4-[[5-fluoro-4-[3-(1,3-oxazol-2-yl)anilino]pyrimidin-2-yl]amino]benzamide?
4-[[5-fluoro-4-[3-(1,3-oxazol-2-yl)anilino]pyrimidin-2-yl]amino]benzamide has a molecular weight of 390.38 g/mol, XLogP of 3.86, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-fluoro-4-[3-(1,3-oxazol-2-yl)anilino]pyrimidin-2-yl]amino]benzamide is sourced from PubChem (CID 25071925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).